| Identification | |
| Name: | 2-Propenal,3-(2-methoxyphenyl)- |
| Synonyms: | Cinnamaldehyde,o-methoxy- (6CI,7CI,8CI);3-(2-Methoxyphenyl)-2-propenal;3-(2-Methoxyphenyl)acrylaldehyde;NSC 114599;o-Methoxycinnamaldehyde;o-Methoxycinnamic aldehyde; |
| CAS: | 1504-74-1 |
| EINECS: | 216-131-3 |
| Molecular Formula: | C10H10O2 |
| Molecular Weight: | 162.18 |
| InChI: | InChI=1/C10H10O2/c1-12-10-7-3-2-5-9(10)6-4-8-11/h2-8H,1H3/b6-4+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 44-48 oC |
| Density: | 1.068 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.559 |
| Solubility: | Insoluble |
| Appearance: | Yellow crystals. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
