| Identification | |
| Name: | Propanedioic acid,2-(2-methoxyphenoxy)-, 1,3-dimethyl ester |
| Synonyms: | Propanedioicacid, (2-methoxyphenoxy)-, dimethyl ester (9CI);Dimethyl(o-methoxyphenoxy)malonate;Dimethyl 2-(2-methoxyphenoxy)malonate;Dimethyl2-methoxyphenoxymalonate;2-(2-Methoxyphenoxy)malonic acid dimethyl ester; |
| CAS: | 150726-89-9 |
| Molecular Formula: | C12H14O6 |
| Molecular Weight: | 254.24 |
| InChI: | InChI=1/C12H14O6/c1-15-8-6-4-5-7-9(8)18-10(11(13)16-2)12(14)17-3/h4-7,10H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.206 g/cm3 |
| Refractive index: | 1.497 |
| Appearance: | White Solid |
| Specification: |
The CAS register number of Dimethyl 2-(2-methoxyphenoxy)malonate is 150726-89-9. It also can be called as 2-(2-Methoxyphenoxy)malonic acid dimethyl ester and the systematic name about this chemical is dimethyl (2-methoxyphenoxy)propanedioate. The molecular formula about this chemical is C12H14O6 and the molecular weight is 254.24. It belongs to the following product categories, such as Aromatics Compounds; Aromatics and so on. Physical properties about Dimethyl 2-(2-methoxyphenoxy)malonate are: (1)ACD/LogP: 2.05; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 3; (5)ACD/BCF (pH 7.4): 3; (6)ACD/KOC (pH 5.5): 73; (7)ACD/KOC (pH 7.4): 73; (8)#H bond acceptors: 6; (9)#Freely Rotating Bonds: 7; (10)Polar Surface Area: 71.06Å2; (11)Index of Refraction: 1.497; (12)Molar Refractivity: 61.65 cm3; (13)Molar Volume: 210.806 cm3; (14)Polarizability: 24.44x10-24cm3; (15)Surface Tension: 38.939 dyne/cm; (16)Enthalpy of Vaporization: 56.214 kJ/mol; (17)Boiling Point: 320.47 °C at 760 mmHg. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
