| Identification |
| Name: | 1,3-Dimethoxy benzene |
| Synonyms: | Dimethyl resorcinol; m-Dimethoxybenzene; Resorcinol dimethyl ether; Dimethylresorcinol; 3?Methoxyanisole; Dimethylether resorcinolu (Czech); Benzene, 1,3 - dimethoxy -; Benzene, m-dimethoxy -; 1,3-Dimethoxybenzeen; 1,3-Dimethoxybenzene; Dimethylether resorcinolu |
| CAS: | 151-10-0 |
| EINECS: | 205-783-4 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-9-7-4-3-5-8(6-7)10-2/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -52oC |
| Density: | 1.055 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.523-1.525 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless liquid. |
| Packinggroup: | Z01 |
| HS Code: | 29093090 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
