| Identification | |
| Name: | 1H-Inden-1-one,4-chloro-2,3-dihydro- |
| Synonyms: | 1-Indanone,4-chloro- (6CI,7CI,8CI);4-Chloroindan-1-one; |
| CAS: | 15115-59-0 |
| Molecular Formula: | C9H7ClO |
| Molecular Weight: | 166.6 |
| InChI: | InChI=1/C9H7ClO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.312 g/cm3 |
| Refractive index: | 1.6 |
| Appearance: | White to yellow crystal or oil |
| Specification: |
1H-Inden-1-one,4-chloro-2,3-dihydro- , with CAS number of 15115-59-0, can be called 1H-inden-1-one, 4-chloro-2,3-dihydro- ; 4-Chlorindan-1-on ; 4-chloro-2,3-dihydro-1H-inden-1-one ; 4-Chloroindan-1-one ; 15115-59-0 [RN] ; 4-Chloro-1-indanone ; 4-Chloro-2,3-dihydroinden-1-one . |
| Safety Data | |
 |
|
