Identification |
Name: | Dibenz[b,e]oxepin-6,11-dione |
Synonyms: | Benzoicacid, o-salicyloyl-, e-lactone (6CI,7CI); NSC 77975; e-Lactone of 2-carboxy-2'-hydroxybenzophenone |
CAS: | 15128-50-4 |
Molecular Formula: | C14H8 O3 |
Molecular Weight: | 224.2115 |
InChI: | InChI=1/C14H8O3/c15-13-9-5-1-2-6-10(9)14(16)17-12-8-4-3-7-11(12)13/h1-8H |
Molecular Structure: |
 |
Properties |
Flash Point: | 184.6°C |
Boiling Point: | 407.2°Cat760mmHg |
Density: | 1.335g/cm3 |
Refractive index: | 1.637 |
Flash Point: | 184.6°C |
Safety Data |
|
 |