Identification |
Name: | Chryseno[5,6-b]oxirene,1a,11b-dihydro- |
Synonyms: | Chrysene,5,6-epoxy-5,6-dihydro- (8CI); Chryseno[5,6-b]oxirene, 1a,11c-dihydro- (9CI);5,6-Epoxy-5,6-dihydrochrysene; Chrysene 5,6-epoxide; Chrysene 5,6-oxide;Chrysene, K-region epoxide; Oxireno[g]chrysene, 1a,11c-dihydro- |
CAS: | 15131-84-7 |
Molecular Formula: | C18H12 O |
Molecular Weight: | 244.30 |
InChI: | InChI=1/C18H12O/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-18(19-17)16(12)14/h1-10,17-18H |
Molecular Structure: |
![(C18H12O) Chrysene,5,6-epoxy-5,6-dihydro- (8CI); Chryseno[5,6-b]oxirene, 1a,11c-dihydro- (9CI);5,6-Epoxy-5,6-d...](https://img1.guidechem.com/chem/e/dict/81/15131-84-7.jpg) |
Properties |
Flash Point: | 212.4°C |
Boiling Point: | 447.3°Cat760mmHg |
Density: | 1.285g/cm3 |
Refractive index: | 1.73 |
Specification: |
Chrysene-5,6-oxide , its cas register number is 15131-84-7. It also can be called Chrysene-5,6-epoxide ; 1a,11c-Dihydrochryseno(5,6-b)oxirene and 5,6-Epoxy-5,6-dihydrochrysene . When heated to decomposition it emits acrid smoke and fumes.
|
Report: |
EPA Genetic Toxicology Program.
|
Flash Point: | 212.4°C |
Safety Data |
|
 |