| Identification | |
| Name: | Acetyl fluoride,fluoro- (6CI,8CI,9CI) |
| Synonyms: | Fluoroacetylfluoride |
| CAS: | 1514-42-7 |
| Molecular Formula: | C2H2 F2 O |
| Molecular Weight: | 80.04 |
| InChI: | InChI=1/C2H2F2O/c3-1-2(4)5/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Flash Point: | 13.3°C |
| Boiling Point: | 68.3°Cat760mmHg |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.266 |
| Specification: |
Fluoroacetyl fluoride with cas registry number of 1514-42-7 is also known as Fluorid kyseliny fluoroctove ; Fluoroacetyl fluoride ; Acetyl fluoride, fluoro- ; Fluoro-acetylfluorid ; 1,2-Difluoroethanone . It would emit very toxic vapors when heated to decomposition. Fluoroacetyl fluoride with cas registry number of 1514-42-7 is used as a pharmaceutical intermediate . |
| Flash Point: | 13.3°C |
| Safety Data | |
 |
|
