| Identification | |
| Name: | 1H-Pyrazol-3-amine,4-(1-methylethyl)- |
| Synonyms: | 1H-Pyrazol-3-amine, 4-(1-methylethyl)-; |
| CAS: | 151521-49-2 |
| Molecular Formula: | C6H11N3 |
| Molecular Weight: | 125.17 |
| InChI: | InChI=1/C6H11N3/c1-4(2)5-3-8-9-6(5)7/h3-4H,1-2H3,(H3,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.104 |
| Refractive index: | 1.57 |
| Specification: |
The 4-Isopropyl-1H-pyrazol-3-amine, with the CAS registry number 151521-49-2, is also known as 1H-Pyrazol-3-amine, 4-(1-methylethyl)-. It belongs to the product categories of Amineprimary; Pyrazole. This chemical's molecular formula is C6H11N3 and molecular weight is 125.17. Its IUPAC name is called 4-propan-2-yl-1H-pyrazol-5-amine. Physical properties of 4-Isopropyl-1H-pyrazol-3-amine: (1)ACD/LogP: 0.31; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.104; (4)ACD/LogD (pH 7.4): 0.305; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1.003; (7)ACD/KOC (pH 5.5): 21.915; (8)ACD/KOC (pH 7.4): 34.792; (9)#H bond acceptors: 3; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.57; (13)Molar Refractivity: 37.198 cm3; (14)Molar Volume: 113.332 cm3; (15)Surface Tension: 50.357 dyne/cm; (16)Density: 1.104 g/cm3; (17)Flash Point: 157.794 °C; (18)Enthalpy of Vaporization: 53.551 kJ/mol; (19)Boiling Point: 295.776 °C at 760 mmHg; (20)Vapour Pressure: 0.001 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
