| Identification | |
| Name: | Thiourea,N-(2-methoxyphenyl)- |
| Synonyms: | Thiourea,(2-methoxyphenyl)- (9CI);Urea, 1-(o-methoxyphenyl)-2-thio- (6CI,7CI,8CI);(o-Methoxyphenyl)thiourea;1-(2-Methoxyphenyl)thiourea;1-(o-Methoxyphenyl)-2-thiourea;1-(o-Methoxyphenyl)thiourea;2-Thioureidoanisole;N-(2-Methoxyphenyl)thiourea;N-(o-Methoxyphenyl)thiourea;NSC 523842; |
| CAS: | 1516-37-6 |
| Molecular Formula: | C8H10N2OS |
| Molecular Weight: | 182.2428 |
| InChI: | InChI=1/C8H10N2OS/c1-11-7-5-3-2-4-6(7)10-8(9)12/h2-5H,1H3,(H3,9,10,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 155-157 ºC(lit.) |
| Flash Point: | 139.7 ºC |
| Boiling Point: | 307.3 ºC at 760 mmHg |
| Density: | 1.287 g/cm3 |
| Refractive index: | 1.677 |
| Specification: |
(2-Methoxyphenyl)thiourea with CAS number of 1516-37-6 is also known as N-(2-methoxyphenyl)thiourea ; O-methoxyphenylthiourea ; 1-(O-methoxyphenyl)-2-thio-ure ; 1-(O-methoxyphenyl)-2-thiourea ; 1-(O-Methoxyphenyl)thiourea ; N-(o-Methoxyphenyl)thiourea ; Thiourea, (2-methoxyphenyl)- ; Urea, 1-(o-methoxyphenyl)-2-thio- . |
| Packinggroup: | III |
| Flash Point: | 139.7 ºC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
