| Identification | |
| Name: | Benzenemethanol,4-methyl-a-phenyl- |
| Synonyms: | Benzhydrol,4-methyl- (6CI,7CI,8CI);1-(4-Methylphenyl)-1-phenylmethanol;4-Methyl-a-phenylbenzenemethanol;4-Methylphenyl(phenyl)methanol;Phenyl(4-tolyl)methanol;Phenyl-p-tolylmethanol;p-Methylbenzhydrol;a-(4-Methylphenyl)benzenemethanol;a-(4-Methylphenyl)phenylmethanol; |
| CAS: | 1517-63-1 |
| EINECS: | 216-171-1 |
| Molecular Formula: | C14H14O |
| Molecular Weight: | 198.26 |
| InChI: | InChI=1/C14H14O/c1-11-7-9-13(10-8-11)14(15)12-5-3-2-4-6-12/h2-10,14-15H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Flash Point: | > 110 C |
| Density: | 1.081 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.59 |
| Solubility: |
Appearance:white
crystals Transport Information:200kgs Hazard Symbols:Not regulated UN NO. Safety:S24/25 |
| Appearance: | white crystals |
| Specification: |
4-Methylbenzhydrol (CAS NO.1517-63-1),its Synonyms are Benzenemethanol, 4-methyl-alpha-phenyl- ; Alpha-p-Tolylbenzyl alcohol ; Benzhydrol, 4-methyl- ; NSC 5324 ; p-Methylbenzhydrol . It is white to off-white powder. |
| Flash Point: | > 110 C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols | |
 |
|
