| Identification | |
| Name: | Diethyldithiocarbamic acid diethylammonium salt |
| Synonyms: | DIETHYLAMMONIUM DIETHYLDITHIOCARBAMATE;DIETHYLDITHIOCARBAMIC ACID DIETHYLAMMONIUM SALT;DIETHYLDITHIONE DIETHYLAMMONIUM SALT;Carbamic acid, diethyldithio-, compd. with diethylamine (1:1);Carbamic acid, diethyldithio-, diethylamine salt;Carbamodithioic acid, diethyl-, compd. with N-ethylethanamine (1:1);Carbamodithioicacid,diethyl-,compd.withN-ethylethanamine(1:1);Contramine |
| CAS: | 1518-58-7 |
| EINECS: | 216-175-3 |
| Molecular Formula: | C9H20N2S2 |
| Molecular Weight: | 220.401 |
| InChI: | InChI=1S/C9H22N2S2/c1-5-10(6-2)9(12)13-11(7-3)8-4/h5-8,11H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 82-84 °C(lit.) |
| Flash Point: | 60.5°C |
| Boiling Point: | 176.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Diethylammonium diethyldithiocarbamate ,its cas register number is 1518-58-7. It also can be called Diethylamine, diethyldithiocarbamate ; Ammonium acid arsenate ; Carbamodithioic acid, N,N-diethyl-, compd. with N-ethylethanamine (1:1) ; and N-Ethylethanaminium diethylcarbamodithioate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 60.5°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
