| Identification | |
| Name: | Estetrol |
| CAS: | 15183-37-6 |
| Molecular Formula: | C18H24O4 |
| Molecular Weight: | 304.3808 |
| InChI: | InChI=1/C18H24O4/c1-18-7-6-12-11-5-3-10(19)8-9(11)2-4-13(12)14(18)15(20)16(21)17(18)22/h3,5,8,12-17,19-22H,2,4,6-7H2,1H3/t12?,13-,14?,15?,16?,17+,18+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.343 g/cm3 |
| Refractive index: | 1.65 |
| Usage: | A metabolite of Estradiol. It is an estrogenic steroid synthesized exclusively by the fetal liver during human pregnancy and reaching the maternal circulation through the placenta. |
| Safety Data | |
 |
|
