| Identification |
| Name: | Benzenamine,4-ethenyl- |
| Synonyms: | Aniline,p-vinyl- (6CI,7CI,8CI);4-Ethenylbenzenamine;4-Vinylaniline;4-Vinylbenzenamine;4-Vinylphenylamine;p-Aminostyrene;p-Ethenylaniline;p-Vinylaniline; |
| CAS: | 1520-21-4 |
| EINECS: | 216-185-8 |
| Molecular Formula: | C8H9N |
| Molecular Weight: | 119.1638 |
| InChI: | InChI=1S/C8H9N/c1-2-7-3-5-8(9)6-4-7/h2-6H,1,9H2 |
| Molecular Structure: |
 |
| Properties |
| Stability: | Stable, but 0.1% sodium hydroxide may be added to inhibit polymerisation. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.626(lit.) |
| Water Solubility: | Stability Stable, but 0.1% sodium hydroxide may be added to inhibit polymerisation. Incompatible with strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Tox |
| Solubility: | |
| Appearance: | liquid |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Safety Data |
| |
 |
