| Identification | |
| Name: | Butanoic acid,2-fluoro-3-oxo-, ethyl ester |
| Synonyms: | Acetoaceticacid, 2-fluoro-, ethyl ester (7CI,8CI);Acetoacetic acid, fluoro-, ethyl ester(6CI);2-Fluoro-3-oxobutanoic acid ethyl ester;Ethyl 2-fluoro-3-oxobutanoate;Ethyl 2-fluoro-3-oxobutyrate;NSC 24563; |
| CAS: | 1522-41-4 |
| Molecular Formula: | C6H9FO3 |
| Molecular Weight: | 148.13 |
| InChI: | InChI=1/C6H9FO3/c1-3-10-6(9)5(7)4(2)8/h5H,3H2,1-2H3/t5-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 194? |
| Refractive index: | 1.414 |
| Appearance: | Clear colorless liquid |
| Specification: |
Ethyl 2-fluoroacetoacetate (1522-41-4) also can be called Butanoic acid, 2-fluoro-3-oxo-, ethyl ester and 3-Fluoropyridine-2-carboxylic acid . |
| Flash Point: | 194? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
