4-Pyridinemethanol,3-amino- (152398-05-5)

The 3-Amino-4-hydroxymethylpyridine with the cas number 152398-05-5 is also called 4-Pyridinemethanol,3-amino-. Both the systematic name and IUPAC name are (3-aminopyridin-4-yl)methanol. Its molecular formula is C₆H₈N₂O. This chemical belongs to the following product categories: (1)PYRIDINE; (2)pharmacetical; (3)API intermediates.

The properties of the chemical are: (1)ACD/LogP: -1.19; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 3; (6)ACD/KOC (pH 7.4): 5; (7)#H bond acceptors: 3; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 59.14 Å²; (11)Index of Refraction: 1.628; (12)Molar Refractivity: 35.032 cm³; (13)Molar Volume: 98.754 cm³; (14)Polarizability: 13.888×10^-24cm³; (15)Surface Tension: 65.366 dyne/cm; (16)Enthalpy of Vaporization: 64.673 kJ/mol; (17)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OCc1ccncc1N
(2)InChI: InChI=1/C6H8N2O/c7-6-3-8-2-1-5(6)4-9/h1-3,9H,4,7H2
(3)InChIKey: VXHFPFMVXWCZLH-UHFFFAOYAI