The Iron(II) tetrafluoroborate, with CAS registry number 15283-51-9, has the systematic name of iron(2+) ditetrafluoroborate. And its IUPAC name is the same one. Besides this, it is also called borate(1-), tetrafluoro-, iron(2+) (2:1). And this chemical is a kind of yellow-green odorless aqueous solution. What's more, its EINECS is 239-327-0.
Physical properties of Iron(II) tetrafluoroborate: (1)#H bond acceptors: 0; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 0 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: [Fe+2].F[B-](F)(F)F.F[B-](F)(F)F
(2)InChI: InChI=1/2BF4.Fe/c2*2-1(3,4)5;/q2*-1;+2
(3)InChIKey: GXZXLFFLHJJJLX-UHFFFAOYAO
(4)Std. InChI: InChI=1S/2BF4.Fe/c2*2-1(3,4)5;/q2*-1;+2
(5)Std. InChIKey: GXZXLFFLHJJJLX-UHFFFAOYSA-N
|