| Identification |
| Name: | Benzaldehyde,3-fluoro-, 2-[(3-fluorophenyl)methylene]hydrazone |
| Synonyms: | Benzaldehyde,3-fluoro-, [(3-fluorophenyl)methylene]hydrazone (9CI); Benzaldehyde, m-fluoro-,azine (8CI); 3,3'-Difluorobenzaldazine |
| CAS: | 15332-10-2 |
| Molecular Formula: | C14H10 F2 N2 |
| Molecular Weight: | 244.24 |
| InChI: | InChI=1/C14H10F2N2/c15-13-5-1-3-11(7-13)9-17-18-10-12-4-2-6-14(16)8-12/h1-10H/b17-9+,18-10+ |
| Molecular Structure: |
![(C14H10F2N2) Benzaldehyde,3-fluoro-, [(3-fluorophenyl)methylene]hydrazone (9CI); Benzaldehyde, m-fluoro-,azine (8...](https://img1.guidechem.com/chem/e/dict/41/15332-10-2.jpg) |
| Properties |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | 151.3°C |
| Boiling Point: | 326.6°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.539 |
| Biological Activity: | Novel allosteric potentiator of the metabotropic glutamate receptor mGlu 5 . Devoid of agonist activity itself, but potentiates (3-6-fold) the action of agonists at mGlu 5 without any effect at other mGlu subtypes (EC 50 for potentiation = 2-5.3 μ M). |
| Flash Point: | 151.3°C |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
| |
 |
