| Identification |
| Name: | Ethanethioic acid,S-methyl ester (9CI) |
| Synonyms: | Aceticacid, thio-, S-methyl ester (6CI,7CI,8CI);Methanethiol acetate;S-Methylethanethioate;S-Methyl thioacetate;S-Methylthioacetic acid; |
| CAS: | 1534-08-3 |
| EINECS: | 216-252-1 |
| Molecular Formula: | C3H6OS |
| Molecular Weight: | 90.14 |
| InChI: | InChI=1/C3H6OS/c1-3(4)5-2/h1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1992 |
| Density: | 1.024 |
| Water Solubility: | soluble in oil and alcohol |
| Solubility: | soluble in oil and alcohol |
| Appearance: | colourless to pale yellow liquid |
| Packinggroup: | II |
| Safety Data |
| |
 |
