| Identification |
| Name: | Benzene-2,3,4,5-d4-aceticacid, 6-[(2,6-dichlorophenyl)amino]- |
| Synonyms: | DICLOFENACD4(PHENYLD4);2((2,6Dichlorophenyl)aminobenzeneaceticAcidd4,;DiclofenacD4(Major) |
| CAS: | 153466-65-0 |
| Molecular Formula: | C14H7 Cl2 D4 N O2 |
| Molecular Weight: | 300.17 |
| InChI: | InChI=1/C14H11Cl2NO2.Na/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1/i1D,2D,4D,7D; |
| Molecular Structure: |
 |
| Properties |
| Usage: | Labeled Diclofenac, a nonsteroidal anti-inflammatory compound and cyclooxygenase (COX) inhibitor.
92% overall isotopic purity. A representative lot was 75% d4, 23% d3 and 2 % d2 |
| Safety Data |
| |
 |
