| Identification | |
| Name: | Acetyl chloride,2-[[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]oxy]- |
| Synonyms: | Acetylchloride, (p-menth-3-yloxy)-, (-)- (8CI); Acetyl chloride, [[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-(9CI); Acetyl chloride, [[5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-, [1R-(1a,2b,5a)]-; (-)-(Menthyloxy)acetyl chloride; (-)-Menthoxyacetyl chloride;l-Menthoxyacetyl chloride |
| CAS: | 15356-62-4 |
| Molecular Formula: | C12H21 Cl O2 |
| Molecular Weight: | 232.75 |
| InChI: | InChI=1/C12H21ClO2/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3/t9-,10+,11-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 3 |
| Flash Point: | >230 °F |
| Boiling Point: | 136 °C / 12mmHg |
| Density: | 1.033 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.469(lit.) |
| Specification: |
(-)-Menthoxyacetyl chloride with cas registry number of 15356-62-4 is also known as 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl chloride . It is used as organic synthesis intermediate. |
| Flash Point: | >230 °F |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
