| Identification | |
| Name: | Boronic acid,B-[4-(1-methylethoxy)phenyl]- |
| Synonyms: | Boronicacid, [4-(1-methylethoxy)phenyl]- (9CI);(4-Isopropyloxyphenyl)boronic acid;4-Isopropoxybenzeneboronic acid; |
| CAS: | 153624-46-5 |
| Molecular Formula: | C9H13BO3 |
| Molecular Weight: | 180.01 |
| InChI: | InChI=1/C9H13BO3/c1-7(2)13-9-5-3-8(4-6-9)10(11)12/h3-7,11-12H,1-2H3 |
| Molecular Structure: | ![(C9H13BO3) Boronicacid, [4-(1-methylethoxy)phenyl]- (9CI);(4-Isopropyloxyphenyl)boronic acid;4-Isopropoxybenzen...](https://img.guidechem.com/casimg/153624-46-5.gif) |
| Properties | |
| Density: | 1.1 g/cm3 |
| Refractive index: | 1.511 |
| Appearance: | Off- White to Light Tan Powder |
| Specification: |
4-Isopropoxylphenylboronic acid , its cas register number is 153624-46-5. It also can be called [4-(Propan-2-yloxy)phenyl]boronic acid ; boronic acid, B-[4-(1-methylethoxy)phenyl]- ; [4-(Propan-2-Yl-Oxy)Phenyl]Boranediol Hydrate . 4-Isopropoxylphenylboronic acid (CAS NO.153624-46-5) is a white to off-white or light tan powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
