| Identification | |
| Name: | Pentanoic acid,2-acetyl-, ethyl ester |
| Synonyms: | Valericacid, 2-acetyl-, ethyl ester (6CI,7CI,8CI); 2-Propyl-3-oxobutanoic acid ethylester; Ethyl 2-acetylpentanoate; Ethyl 2-acetylvalerate; Ethyl2-propyl-3-oxobutanoate; NSC 6764; NSC 67958 |
| CAS: | 1540-28-9 |
| EINECS: | 216-269-4 |
| Molecular Formula: | C9H16 O3 |
| Molecular Weight: | 172.22 |
| InChI: | InChI=1/C9H16O3/c1-4-6-8(7(3)10)9(11)12-5-2/h8H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 82.4°C |
| Boiling Point: | 224°C at 760 mmHg |
| Density: | 0.967g/cm3 |
| Refractive index: | 1.424 |
| Specification: |
The Ethyl 2-propylacetoacetate ,its cas register number is 1540-28-9.It also can be called as Pentanoic acid, 2-acetyl-, ethyl ester and the IUPAC name about this chemicals is ethyl 2-acetylpentanoate .123325-83-7 is its other registry number. Following are the chemical properties about Ethyl 2-propylacetoacetate :(1)#H bond acceptors: 3 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 6 ; (4)Polar Surface Area: 43.37Å2 ; (5)Index of Refraction: 1.424 ; (6)Molar Refractivity: 45.5 cm3 ; (7)Molar Volume: 178 cm3 ; (8)Polarizability: 18.04x10-24cm3 ; (9)Surface Tension: 30.1 dyne/cm ; (10)Enthalpy of Vaporization: 46.05 kJ/mol ; (11)Vapour Pressure: 0.0934 mmHg at 25°C . This chemicals can be described computed from structure: |
| Flash Point: | 82.4°C |
| Safety Data | |
 |
|
