| Identification | |
| Name: | 6H-[1]Benzothiopyrano[4,3-b]quinoline,7-methyl- |
| Synonyms: | BRN 0992794;7-methyl-6H-thiochromeno[4,3-b]quinoline;7-Methyl-6H-(1)benzothiopyrano(4,3-b)quinoline;6H-(1)BENZOTHIOPYRANO(4,3-b)QUINOLINE, 7-METHYL-;1541-60-2;AC1L25GK;LS-41456 |
| CAS: | 1541-60-2 |
| Molecular Formula: | C17H13 N S |
| Molecular Weight: | 263.37 |
| InChI: | InChI=1/C17H13NS/c1-11-12-6-2-4-8-15(12)18-17-13-7-3-5-9-16(13)19-10-14(11)17/h2-9H,10H2,1H3 |
| Molecular Structure: | ![(C17H13NS) BRN 0992794;7-methyl-6H-thiochromeno[4,3-b]quinoline;7-Methyl-6H-(1)benzothiopyrano(4,3-b)quinoline;...](https://img1.guidechem.com/chem/e/dict/22/1541-60-2.jpg) |
| Properties | |
| Flash Point: | 250.7°C |
| Boiling Point: | 491°Cat760mmHg |
| Density: | 1.259g/cm3 |
| Refractive index: | 1.721 |
| Specification: |
7-Methyl-6h-(1)benzothiopyrano(4,3-b)quinoline ,with CAS number of 1541-60-2,can be called BRN 0992794 . |
| Flash Point: | 250.7°C |
| Safety Data | |
 |
|
