| Identification |
| Name: | 1-Piperidinecarboxylicacid, 2-(hydroxymethyl)-, phenylmethyl ester, (2R)- |
| Synonyms: | 1-Piperidinecarboxylicacid, 2-(hydroxymethyl)-, phenylmethyl ester, (+)- |
| CAS: | 154499-13-5 |
| Molecular Formula: | C14H19 N O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H19NO3/c16-10-13-8-4-5-9-15(13)14(17)18-11-12-6-2-1-3-7-12/h1-3,6-7,13,16H,4-5,8-11H2/t13-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 193.52°C |
| Boiling Point: | 396.374°C at 760 mmHg |
| Density: | 1.163g/cm3 |
| Refractive index: | 1.55 |
| Flash Point: | 193.52°C |
| Usage: | Intermediate for the preparation of 1-hydroxyalkyl-3-phenylthioureas as HDL- and Apo A-I-elevating agents |
| Safety Data |
| |
 |
