Identification |
Name: | Benzamide,4-amino-2,3,5,6-tetrafluoro- |
Synonyms: | 4-Amino-2,3,5,6-tetrafluorobenzamide;NSC 97005 |
CAS: | 1548-74-9 |
EINECS: | 216-285-1 |
Molecular Formula: | C7H4 F4 N2 O |
Molecular Weight: | 208.11 |
InChI: | InChI=1/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14) |
Molecular Structure: |
|
Properties |
Melting Point: | 185-186 °C(lit.)
|
Flash Point: | 43.5°C |
Boiling Point: | 148.4°Cat760mmHg |
Density: | 1.635g/cm3 |
Refractive index: | 1.531 |
Specification: | beige crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 43.5°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|