| Identification | |
| Name: | 2-Propenoic acid,2-(hydroxymethyl)-, methyl ester |
| Synonyms: | Acrylicacid, 2-(hydroxymethyl)-, methyl ester (8CI);Hydracrylic acid, 2-methylene-,methyl ester (7CI);Methyl 2-hydroxymethyl-2-propenoate;Methyl a-(hydroxymethyl)acrylate; |
| CAS: | 15484-46-5 |
| Molecular Formula: | C5H8O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H8O3/c1-4(3-6)5(7)8-2/h6H,1,3H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.085 g/cm3 |
| Refractive index: | 1.438 |
| Specification: |
The Methyl 2-(hydroxymethyl)acrylate with the CAS number 15484-46-5 is also called 2-Propenoic acid,2-(hydroxymethyl)-, methyl ester. The systematic name is methyl 2-(hydroxymethyl)prop-2-enoate. Its molecular formula is C5H8O3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 0.52; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 35.53 Å2; (7)Index of Refraction: 1.438; (8)Molar Refractivity: 28.09 cm3; (9)Molar Volume: 106.9 cm3; (10)Polarizability: 11.13×10-24cm3; (11)Surface Tension: 33.7 dyne/cm; (12)Enthalpy of Vaporization: 49.01 kJ/mol; (13)Vapour Pressure: 0.205 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
