| Identification | |
| Name: | Pyridinium,3-[[(dimethylamino)carbonyl]oxy]-1-methyl- |
| Synonyms: | Pyridinium,3-hydroxy-1-methyl-, dimethylcarbamate (6CI); Pyridinium, 3-hydroxy-1-methyl-,dimethylcarbamate (ester) (8CI); Pyridostigmine |
| CAS: | 155-97-5 |
| Molecular Formula: | C9H13 N2 O2 |
| Molecular Weight: | 181.24 |
| InChI: | InChI=1/C9H13N2O2/c1-10(2)9(12)13-8-5-4-6-11(3)7-8/h4-7H,1-3H3/q+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Completely sol in water; practically insol in oils, greases, hydrocarbons, ketones, and esters |
| Specification: |
Pyridostigmine is a parasympathomimetic and a reversible cholinesterase inhibitor. Since it is a quaternary amine, it is poorly absorbed in the gut and does not cross the blood-brain barrier, except possibly in stressful conditions. Contraindications: Pyrostigmine bromide is contraindicated in cases of mechanical intestinal or urinary obstruction and should be used with caution in patients with bronchial asthma . Side effects: Common side effects include: Nausea ;Vomiting ;Diarrhea ;Abdominal cramps ;Increased salivation ;Tearing ;Increased bronchial secretions ;Constricted pupils. |
| Flash Point: | °C |
| Color: | Yellowish-white free-flowing powder |
| Safety Data | |
 |
|
