| Identification | |
| Name: | 2,6-dimethyl-3-nitropyridine |
| Synonyms: | 2,6-Lutidine,3-nitro- (6CI,7CI); 2,6-Dimethyl-3-nitropyridine; 3-Nitro-2,6-dimethylpyridine;3-Nitro-2,6-lutidine; NSC 88939 |
| CAS: | 15513-52-7 |
| EINECS: | 239-543-5 |
| Molecular Formula: | C7H8N2O2 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C7H8N2O2/c1-5-3-4-7(9(10)11)6(2)8-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.45 |
| Refractive index: | 1.551 |
| Appearance: | Off-white to tan powder |
| Specification: |
2,6-Dimethyl-3-nitropyridine (CAS NO.15513-52-7) is also named as Pyridine, 2,6-dimethyl-3-nitro- ; 3-Nitro-2,6-dimethylpyridine ; 3-Nitro-2,6-lutidine . 2,6-Dimethyl-3-nitropyridine (CAS NO.15513-52-7) is off-white to tan powder. |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
