| Identification | |
| Name: | Phenazine,5,10-dihydro-5,10-dimethyl- |
| Synonyms: | 5,10-Dihydro-5,10-dimethylphenazine;5,10-Dimethyl-5,10-dihydrophenazine;N,N'-Dimethylphenazine;NSC 149969; |
| CAS: | 15546-75-5 |
| Molecular Formula: | C14H14N2 |
| Molecular Weight: | 210.27 |
| InChI: | InChI=1/C14H14N2/c1-15-11-7-3-5-9-13(11)16(2)14-10-6-4-8-12(14)15/h3-10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.117 g/cm3 |
| Refractive index: | 1.615 |
| Appearance: | Yellowish crystal |
| Specification: |
5,10-Dimethyldihydrophenazine , with CAS number of 15546-75-5, can be called phenazine, 5,10-dihydro-5,10-dimethyl- ; 5,10-Dihydro-5,10-dimethylphenazine ; 5,10-dihydro-5,10-dimethylphenazine 98% . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
