| Identification | |
| Name: | 3-Methoxybenzenethiol |
| Synonyms: | Benzenethiol,m-methoxy- (6CI,7CI,8CI);(m-Methoxyphenyl)thiol;3-Mercaptoanisole;3-Methoxythiophenol;m-Methoxybenzenethiol;m-Methoxythiophenol; |
| CAS: | 15570-12-4 |
| EINECS: | 239-617-7 |
| Molecular Formula: | C7H8OS |
| Molecular Weight: | 140.2 |
| InChI: | InChI=1/C7H8OS/c1-8-6-3-2-4-7(9)5-6/h2-5,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.13 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.585-1.589 |
| Solubility: | Slightly soluble |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
? 3-methoxybenzenethiol , with CAS number of 15570-12-4, can be called benzenethiol, 3-methoxy- ; meta-Methoxybenzenethiol ; 3-Mercaptoanisole ; 3-Methoxy Thiophenol ; 3-Methoxythiophenol . It is a?clear colorless to light yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
