| Identification | |
| Name: | Brometenamine |
| Synonyms: | Brometenamine [INN:DCF];1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane, compd. with tribromomethane (1:1);Brometenamina;Brometenaminum;Equimolecular complex of bromoform and hexamethylenetetramine;Hexamethylenetetramine, compd. with tribromomethane (1:1);UNII-VW6613KQ0H;1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane - tribromomethane (1:1) |
| CAS: | 15585-71-4 |
| Molecular Formula: | C7H13Br3N4 |
| Molecular Weight: | 392.9169 |
| InChI: | InChI=1/C6H12N4.CHBr3/c1-7-2-9-4-8(1)5-10(3-7)6-9;2-1(3)4/h1-6H2;1H |
| Molecular Structure: | ![(C7H13Br3N4) Brometenamine [INN:DCF];1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane, compd. with tribromomethane (1:1...](https://img1.guidechem.com/structure/image/15585-71-4.gif) |
| Properties | |
| Flash Point: | 103.9°C |
| Boiling Point: | 252.7°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 103.9°C |
| Safety Data | |
 |
|
