| Identification | |
| Name: | Benzeneethanamine,2,5-dimethoxy-a,4-dimethyl-,hydrochloride (1:1) |
| Synonyms: | Benzeneethanamine,2,5-dimethoxy-a,4-dimethyl-,hydrochloride (9CI); Phenethylamine, 2,5-dimethoxy-a,4-dimethyl-, hydrochloride (8CI);1-(2,5-Dimethoxy-4-methylphenyl)-2-aminopropane hydrochloride;2,5-Dimethoxy-4-methylamphetamine hydrochloride;dl-2,5-Dimethoxy-4-methylamphetamine hydrochloride |
| CAS: | 15589-00-1 |
| Molecular Formula: | C12H19 N O2 . Cl H |
| Molecular Weight: | 245.78 |
| InChI: | InChI=1/C12H19NO2/c1-8-5-12(15-4)10(6-9(2)13)7-11(8)14-3/h5,7,9H,6,13H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 60.5 to 60.1 deg C |
| Flash Point: | 156ºC |
| Boiling Point: | 312.6ºCat 760 mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.511 |
| Solubility: | In water, 4.88X10+3 mg/L at 25 deg C (est) |
| Specification: |
Amphetamine, 2,5-dimethoxy-4-methyl-, hydrochloride is also known as 1-(2,5-Dimethoxy-4-methylphenyl)-2-aminopropane ; 2,5-Dimethoxy-4-methylamphetamine hydrochloride ; 2,5-Dimethoxy-alpha,4-dimethylphenethylamine hydrochloride ; Phenethylamine, 2,5-dimethoxy-alpha,4-dimethyl-, hydrochloride with CAS Registry Number of 15589-00-1. |
| Flash Point: | 156ºC |
| Safety Data | |
 |
|
