| Identification | |
| Name: | 1,1-Cyclopropanedicarboxylicacid, 1,1-diethyl ester |
| Synonyms: | 1,1-Cyclopropanedicarboxylicacid, diethyl ester (6CI,7CI,8CI,9CI);1,1-Bis(ethoxycarbonyl)cyclopropane;1,1-Dicarbethoxycyclopropane;Ethyl1,1-cyclopropanedicarboxylate;NSC 21376; |
| CAS: | 1559-02-0 |
| EINECS: | 216-321-6 |
| Molecular Formula: | C9H14O4 |
| Molecular Weight: | 186.21 |
| InChI: | InChI=1/C9H14O4/c1-3-12-7(10)9(5-6-9)8(11)13-4-2/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Density: | 1.055 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.432-1.434 |
| Solubility: | Slightly soluble |
| Appearance: | clear colorless liquid |
| Specification: |
?Diethyl cyclopropane-1,1-dicarboxylate (CAS NO.1559-02-0) is also called as?AI3-05554 ; EINECS 216-321-6?; 1,1-Cyclopropanedicarboxylic acid, diethyl ester ; Diethyl cyclopropane-1,1-dicarboxylate . |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
