| Identification | |
| Name: | 1-Cyclopentenecarboxylic acid |
| Synonyms: | 1-Cyclopentenecarboxylicacid;1-Cyclopentenylcarboxylic acid;Isoaleprolic acid;NSC 44968; |
| CAS: | 1560-11-8 |
| Molecular Formula: | C6H8O2 |
| Molecular Weight: | 112.13 |
| InChI: | InChI=1/C6H8O2/c7-6(8)5-3-1-2-4-5/h3H,1-2,4H2,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.215 g/cm3 |
| Solubility: | Very soluble |
| Appearance: | White to pale yellow powder |
| Specification: |
1-Cyclopentene-1-carboxylicacid , its cas register number is 1560-11-8. It also can be called Isoaleprolic acid ; and 1-Cyclopentene-1-carboxylic acid . Its classification code is Drug / Therapeutic Agent. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
