Identification |
Name: | Pentadecane, 2-methyl- |
Synonyms: | 2-Methylpentadecane;NSC 109495 |
CAS: | 1560-93-6 |
Molecular Formula: | C16H34 |
Molecular Weight: | 226.44 |
InChI: | InChI=1/C16H34/c1-4-5-6-7-8-9-10-11-12-13-14-15-16(2)3/h16H,4-15H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | -7 C |
Flash Point: | 95.3°C |
Boiling Point: | 282 C |
Density: | 0.772g/cm3 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
Refractive index: | 1.432 |
Water Solubility: | negligible Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology Skin, respiratory and eye irritant. Toxicity data (The meaning of |
Solubility: | negligible |
Appearance: | colourless liquid |
Flash Point: | 95.3°C |
Safety Data |
|
 |