| Identification | |
| Name: | Cyclohexanol, 2-chloro- |
| Synonyms: | 2-Chloro-1-cyclohexanol;2-Chlorocyclohexanol;Cyclohexene chlorohydrin; |
| CAS: | 1561-86-0 |
| EINECS: | 216-339-4 |
| Molecular Formula: | C6H11ClO |
| Molecular Weight: | 134.6 |
| InChI: | InChI=1/C6H11ClO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4H2/t5-,6+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 70°C |
| Boiling Point: | 218.3°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | n20/D 1.488(lit.) |
| Appearance: | clear colourless to light yellow liquid |
| Specification: | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 70°C |
| Safety Data | |
 |
|
