Identification |
Name: | Cyclohexanol, 2-chloro- |
Synonyms: | 2-Chloro-1-cyclohexanol;2-Chlorocyclohexanol;Cyclohexene chlorohydrin; |
CAS: | 1561-86-0 |
EINECS: | 216-339-4 |
Molecular Formula: | C6H11ClO |
Molecular Weight: | 134.6 |
InChI: | InChI=1/C6H11ClO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4H2/t5-,6+/m0/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 70°C |
Boiling Point: | 218.3°Cat760mmHg |
Density: | 1.12g/cm3 |
Refractive index: | n20/D 1.488(lit.) |
Appearance: | clear colourless to light yellow liquid |
Specification: | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Flash Point: | 70°C |
Safety Data |
|
 |