Identification |
Name: | Phenoxazin-5-ium,1-carboxy-7-(dimethylamino)-3,4-dihydroxy-, chloride |
Synonyms: | C.I.Mordant Blue 10 (7CI,8CI);Gallocyanine (6CI);Phenoxazin-5-ium, 1-carboxy-7-(dimethylamino)-3,4-dihydroxy-,chloride (9CI);Alizarine Navy Blue;Alizarine Navy Blue AT;Anthracene BlueSWGG;Brilliant Chrome Blue P;C.I. 51030;Fast violet;Gallocyanin;Gallocyanine BS;Gallocyanine DH; |
CAS: | 1562-85-2 |
EINECS: | 216-345-7 |
Molecular Formula: | C15H13ClN2O5 |
Molecular Weight: | 336.73 |
InChI: | InChI=1/C15H12N2O5.ClH/c1-17(2)7-3-4-9-11(5-7)22-14-12(16-9)8(15(20)21)6-10(18)13(14)19;/h3-6H,1-2H3,(H2-,16,18,19,20,21);1H |
Molecular Structure: |
 |
Properties |
Density: | g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Appearance: | black |
Specification: | black powder Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |