| Identification | |
| Name: | Diazene,1,2-bis(4-methoxyphenyl)-, 1-oxide |
| Synonyms: | Anisole,4,4'-azoxydi- (6CI); Azoxybenzene, 4,4'-dimethoxy- (8CI); Diazene,bis(4-methoxyphenyl)-, 1-oxide (9CI); 4,4'-Azoxyanisole; 4,4'-Azoxydianisole;4,4'-Dimethoxyazoxybenzene; Bis(4-methoxyphenyl)diazene oxide; NSC 7959;p,p'-Azoxyanisole; p,p'-Azoxydianisole; p,p'-Dimethoxyazoxybenzene;p-Azoxyanisole; p-Azoxydianisole |
| CAS: | 1562-94-3 |
| EINECS: | 216-348-3 |
| Molecular Formula: | C14H14 N2 O3 |
| Molecular Weight: | 258.27 |
| InChI: | InChI=1/C14H14N2O3/c1-18-13-7-3-11(4-8-13)15-16(17)12-5-9-14(19-2)10-6-12/h3-10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 132 °C |
| Flash Point: | 206.6°C |
| Boiling Point: | 417.9°Cat760mmHg |
| Density: | 1.14g/cm3 |
| Refractive index: | 1.555 |
| Specification: | bright yellow crystalline powder Safety Statements:36/37/39-26-22-16-24/25 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust 16:Keep away from sources of ignition - No smoking 24/25:Avoid contact with skin and eyes |
| Flash Point: | 206.6°C |
| Safety Data | |
 |
|
