| Identification | |
| Name: | 4-Quinolinol,2,6-dimethyl- |
| Synonyms: | 2,6-Dimethyl-4-hydroxyquinoline;2,6-Dimethyl-4-quinolinol; NSC 139469 |
| CAS: | 15644-82-3 |
| Molecular Formula: | C11H11 N O |
| Molecular Weight: | 173.2111 |
| InChI: | InChI=1/C11H11NO/c1-7-3-4-10-9(5-7)11(13)6-8(2)12-10/h3-6H,1-2H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 283-287 ºC |
| Density: | 1.107 g/cm3 |
| Refractive index: | 1.566 |
| Specification: |
2,6-Dimethyl-4-quinolinol , with CAS number of 15644-82-3, can be called 4(1H)-quinolinone, 2,6-dimethyl- ; 2,6-Dimethylquinolin-4(1H)-one ; 4-quinolinol, 2,6-dimethyl- ; 2,6-Dimethylquinolin-4-ol . |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
