| Identification | |
| Name: | 1-Butanol, 2-methyl-,(2S)- |
| Synonyms: | 1-Butanol,2-methyl-, (S)- (8CI); 1-Butanol, 2-methyl-, (S)-(-)- (7CI); 1-Butanol,2-methyl-, l- (4CI); (-)-(S)-2-Methyl-1-butanol; (-)-2-Methyl-1-butanol;(-)-2-Methylbutanol; (2S)-2-Methylbutan-1-ol; (S)-(-)-2-Methyl-1-butanol;(S)-(-)-2-Methylbutanol; (S)-2-Methyl-1-butanol; D-(-)-2-Methyl-1-butanol |
| CAS: | 1565-80-6 |
| EINECS: | 216-366-1 |
| Molecular Formula: | C5H12 O |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C5H12O/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1105 |
| Melting Point: | -70 ºC |
| Flash Point: | 43 ºC |
| Boiling Point: | 128 ºC |
| Density: | 0.81 |
| Stability: | No data. |
| Refractive index: | 1.409-1.411 |
| Alpha: | -5.8 º (NEAT 23 ºC) |
| Water Solubility: | 36 G/L (30 ºC) |
| Solubility: | 36 g/L (30 ºC) in water |
| Appearance: | clear, colorless liquid |
| Specification: |
(S)-(-)-2-Methyl-1-butanol (1565-80-6) is a chiral compound with propertie of clear colourless liquid. It is also known as (S)-1-Butano ; (S)-2-Methyl-butan-1-ol ; Amyl alcohol, N- ; Amyl alcohol ; Amyl alcohol, normal ; Alcohol c5 ; 1-Pentanol alcohol ; 1-Pentyl alcohol . When you don't use it, keep away from sources of ignition and store in a tightly closed container in a cool, dry place in flammables-area. |
| Packinggroup: | II; III |
| Flash Point: | 43 ºC |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Flammables-area. |
| Color: | COLORLESS LIQ |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
