| Identification | |
| Name: | 3,5-DifluoroPhenylboronic acid |
| Synonyms: | 3,5-Difluorobenzeneboronic acid;3,5-Difluorophenyl boronic acid;3,5-Difluoro Phenylboronic acid;Boronic acid, B-(3,5-difluorophenyl)-; |
| CAS: | 156545-07-2 |
| Molecular Formula: | C6H5BF2O2 |
| Molecular Weight: | 157.91 |
| InChI: | InChI=1/C13H11BF2O3/c15-12-10(14(17)18)6-7-11(13(12)16)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 115.2oC |
| Boiling Point: | 266.9oC;Cat760mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.562 |
| Appearance: | White to beige-yellowish powder |
| Specification: |
?3,5-DifluoroPhenylboronic acid?(CAS NO.156545-07-2) is also called as?3,5-Difluorobenzeneboronic acid ; Boronic acid, (3,5-difluorophenyl)- (9ci) ; 3,5-Difluorobenzeneboronic acid 98% ; 3,5-Difluorobenzeneboronicacid98% ; 3,5-Difluorophenylboronic acid 98% . |
| Flash Point: | 115.2oC |
| Usage: | 3,5-DifluoroPhenylboronic acid (CAS NO.156545-07-2) is used as intermediates of liquid crystals. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
