| Identification | |
| Name: | Boronic acid,B-(6-methoxy-2-naphthalenyl)- |
| Synonyms: | Boronic acid,(6-methoxy-2-naphthalenyl)- (9CI);(6-Methoxy-2-naphthalenyl)boronic acid;6-Methoxynaphthalene-2-boronic acid; |
| CAS: | 156641-98-4 |
| EINECS: | -0 |
| Molecular Formula: | C11H11BO3 |
| Molecular Weight: | 202.01 |
| InChI: | InChI=1/C12H13BO3/c1-2-16-12-6-4-9-7-11(13(14)15)5-3-10(9)8-12/h3-8,14-15H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.603 |
| Appearance: | White to off-white crystalline powder |
| Specification: |
6-Methoxy-2-naphthaleneboronic acid , its cas register number is 156641-98-4. It also can be called 6-Methoxynaphthalene-2-Boronic Acid ; 6-Methoxynaphthyl-2-Boronic Acid ; (6-Methoxy-2-Naphthyl)Boronic Acid ; (6-Methoxy-2-Naphthalenyl)Boronic Acid ; 6-Methoxy-2-Naphthaleneboronic .It is a white to off-white crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
