Identification |
Name: | 2(3H)-Furanone,dihydro-3,4-dihydroxy-, (3R,4R)- |
Synonyms: | g-Lactone of D-erythronic acid;D-Erythronolactone;D-Erythrono-g-lactone;D-Erythrono-1,4-lactone;D-Erythronic g-lactone;Erythronic acid, g-lactone, D- (8CI);D-Erythronic acid, g-lactone (6CI);2(3H)-Furanone,dihydro-3,4-dihydroxy-, (3R-cis)-; |
CAS: | 15667-21-7 |
Molecular Formula: | C4H6O4 |
Molecular Weight: | 118.09 |
InChI: | InChI=1/C4H6O4/c5-2-1-8-4(7)3(2)6/h2-3,5-6H,1H2/t2-,3-/m1/s1 |
Molecular Structure: |
|
Properties |
Density: | 1.681 g/cm3 |
Refractive index: | -71 ° (C=1, H2O) |
Appearance: | white to light yellow crystal powde |
Usage: | A chiral synthon used for the synthesis of certain natural products such as the leukotrienes |
Safety Data |
|
|