| Identification |
| Name: | Thiazole,2-ethyl-4-methyl- |
| Synonyms: | 2-Ethyl-4-methylthiazole; |
| CAS: | 15679-12-6 |
| EINECS: | 239-757-9 |
| Molecular Formula: | C6H9NS |
| Molecular Weight: | 127.2 |
| InChI: | InChI=1/C6H9NS/c1-3-6-7-5(2)4-8-6/h4H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 3 |
| Density: | 1.025 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | n20/D 1.505(lit.) |
| Solubility: | Slightly soluble |
| Appearance: | clear colorless or pale yellow to light brown liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
