| Identification | |
| Name: | Phenol,4-methoxy-2-nitro- |
| Synonyms: | 2-Hydroxy-5-methoxynitrobenzene;2-Nitro-4-methoxyphenol; |
| CAS: | 1568-70-3 |
| Molecular Formula: | C7H7NO4 |
| Molecular Weight: | 169.13 |
| InChI: | InChI=1/C7H7NO4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.367 g/cm3 |
| Appearance: | yellow solid |
| Specification: | orange-brown powder and chunks Safety Statements:26-37/39-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 24/25:Avoid contact with skin and eyes |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
