| Identification | |
| Name: | D(-)-Arginine |
| Synonyms: | Arginine,D- (8CI);(R)-Arginine;D-2-Amino-5-guanidinovalerate;(2R)-2-amino-5-(carbamimidamido)pentanoic acid; |
| CAS: | 157-06-2 |
| EINECS: | 205-866-5 |
| Molecular Formula: | C6H14N4O2 |
| Molecular Weight: | 174.2 |
| InChI: | InChI=1/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.46 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -28.5 o (C=8, 6 N HCL) |
| Water Solubility: | SOLUBLE |
| Solubility: | soluble |
| Appearance: | white to light yellow crystal powde |
| Specification: |
??D-Arginine , with CAS number of 157-06-2, can be called R-(-)-arginine ; (r)-2-amino-5-guanidinopentanoic acid ; arginine, d- ; h-d-arg-oh ; d-arg ; d-(-)-arginine ; d-arginine .?It is a?white to light yellow crystal powde. D-Arginine (CAS NO.157-06-2) is used for biochemical research. |
| Storage Temperature: | Store at 0-5 |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
