| Identification |
| Name: | 7H-Pyrrolo[2,3-d]pyrimidine,6,7-dimethyl-2,4-di-1-pyrrolidinyl- |
| Synonyms: | PNU 89843;U 89843; U 89843A |
| CAS: | 157013-32-6 |
| Molecular Formula: | C16H23 N5 |
| Molecular Weight: | 285.3873 |
| InChI: | InChI=1/C16H23N5/c1-12-11-13-14(19(12)2)17-16(21-9-5-6-10-21)18-15(13)20-7-3-4-8-20/h11H,3-10H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 259.8°C |
| Boiling Point: | 505.9°Cat760mmHg |
| Density: | 1.32g/cm3 |
| Refractive index: | 1.701 |
| Biological Activity: | Positive allosteric modulator of GABA A receptors. Enhances GABA-induced Cl - currents in the α 1 β 2 γ 2 , α 3 β 2 γ 2 and α 6 β 2 γ 2 subtypes. Causes sedation in vivo following i.v. administration without losing "righting reflex". Also displays antioxidant activity. |
| Flash Point: | 259.8°C |
| Safety Data |
| |
 |
