| Identification | |
| Name: | Butanoic acid,2-methyl-, butyl ester |
| Synonyms: | Butyricacid, 2-methyl-, butyl ester (8CI);Butyl 2-methylbutanoate;n-Butyl 2-methylbutyrate; |
| CAS: | 15706-73-7 |
| EINECS: | 239-798-2 |
| Molecular Formula: | C9H18O2 |
| Molecular Weight: | 158.238 |
| InChI: | InChI=1S/C9H18O2/c1-4-6-7-11-9(10)8(3)5-2/h8H,4-7H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 3/PG 3 |
| Melting Point: | 174-176 ºC |
| Density: | 0.874 g/cm3 |
| Refractive index: | 1.416 |
| Appearance: | colorless clear liquid |
| Specification: |
2-methyl butyl butyrate , its CAS NO. is 15706-73-7, the synonyms are Butanoic acid, 2-methyl-, butyl ester ; Butyl 2-methylbutanoate ; Butyric acid, 2-methyl-, butyl ester ; alpha-Butyl 2-methylbutylate ; n-Butyl-2-methylbutyrate . |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
