| Identification | |
| Name: | 1H-Pyrazol-3-amine,5-phenyl- |
| Synonyms: | Pyrazole,3(or 5)-amino-5(or 3)-phenyl- (7CI);Pyrazole, 3-amino-5-phenyl- (8CI);3-Amino-5-phenyl-1H-pyrazole;3-Amino-5-phenyl-2H-pyrazole;3-Phenyl-1H-pyrazol-5-amine;3-Phenyl-5-aminopyrazole;3-Phenyl-5-pyrazolamine;5-Phenyl-1-pyrazol-3-amine;5-Phenyl-1H-pyrazol-3-amine;5-Phenyl-1H-pyrazol-3-ylamine;5-Phenyl-3-aminopyrazole;5-Phenyl-3-pyrazolamine; |
| CAS: | 1572-10-7 |
| Molecular Formula: | C9H9N3 |
| Molecular Weight: | 159.19 |
| InChI: | InChI=1/C9H9N3/c10-9-6-8(11-12-9)7-4-2-1-3-5-7/h1-6H,(H3,10,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 251.5°C |
| Boiling Point: | 442.3°C at 760 mmHg |
| Density: | 1.238g/cm3 |
| Refractive index: | 1.662 |
| Appearance: | brown solid |
| Specification: | Off-white to cream colored crystalline powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 251.5°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
