Identification |
Name: | m-nitrobenzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
Synonyms: | m-Nitrobenzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);3-nitrobenzoic acid - 2,2',2''-nitrilotriethanol (1:1) |
CAS: | 15728-19-5 |
EINECS: | 239-822-1 |
Molecular Formula: | C13H20N2O7 |
Molecular Weight: | 316.3071 |
InChI: | InChI=1/C7H5NO4.C6H15NO3/c9-7(10)5-2-1-3-6(4-5)8(11)12;8-4-1-7(2-5-9)3-6-10/h1-4H,(H,9,10);8-10H,1-6H2 |
Molecular Structure: |
![(C13H20N2O7) m-Nitrobenzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);3-nitrobenzoic acid - 2,2',2''-n...](https://img1.guidechem.com/structure/image/15728-19-5.gif) |
Properties |
Flash Point: | 157.5°C |
Boiling Point: | 340.7°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 157.5°C |
Safety Data |
|
![](/images/detail_15.png) |